C8H6Br2F3NO — CID 60759570
3,5-dibromo-4-(2,2,2-trifluoroethoxy)aniline (PubChem CID 60759570) has the molecular formula C8H6Br2F3NO and a molecular weight of 348.94 g/mol. Its IUPAC name is 3,5-dibromo-4-(2,2,2-trifluoroethoxy)aniline.
| Compound Name | 3,5-dibromo-4-(2,2,2-trifluoroethoxy)aniline |
|---|---|
| PubChem CID | 60759570 |
| Molecular Formula | C8H6Br2F3NO |
| Molecular Weight | 348.94 g/mol |
| Exact Mass | 346.88 |
| IUPAC Name | 3,5-dibromo-4-(2,2,2-trifluoroethoxy)aniline |
| SMILES | Nc1cc(Br)c(OCC(F)(F)F)c(Br)c1 |
| InChI | InChI=1S/C8H6Br2F3NO/c9-5-1-4(14)2-6(10)7(5)15-3-8(11,12)13/h1-2H,3,14H2 |
| InChIKey | WDGUXFPPXAIUJE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.94 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|