C19H23N5O3S2 — CID 6092962
N-[4-[(Z)-[[5-(dimethylsulfamoyl)-2-methylphenyl]carbamothioylhydrazinylidene]methyl]phenyl]acetamide (PubChem CID 6092962) has the molecular formula C19H23N5O3S2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-[4-[(Z)-[[5-(dimethylsulfamoyl)-2-methylphenyl]carbamothioylhydrazinylidene]methyl]phenyl]acetamide.
| Compound Name | N-[4-[(Z)-[[5-(dimethylsulfamoyl)-2-methylphenyl]carbamothioylhydrazinylidene]methyl]phenyl]acetamide |
|---|---|
| PubChem CID | 6092962 |
| Molecular Formula | C19H23N5O3S2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.12 |
| IUPAC Name | N-[4-[(Z)-[[5-(dimethylsulfamoyl)-2-methylphenyl]carbamothioylhydrazinylidene]methyl]phenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(/C=N\NC(=S)Nc2cc(S(=O)(=O)N(C)C)ccc2C)cc1 |
| InChI | InChI=1S/C19H23N5O3S2/c1-13-5-10-17(29(26,27)24(3)4)11-18(13)22-19(28)23-20-12-15-6-8-16(9-7-15)21-14(2)25/h5-12H,1-4H3,(H,21,25)(H2,22,23,28)/b20-12- |
| InChIKey | IKZOCTPCZRFGNH-NDENLUEZSA-N |
| XLogP | 2.52 |
| TPSA | 102.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|