C12H6Cl2N2O4 — CID 615156
(4-acetyloxy-2,3-dichloro-5,6-dicyanophenyl) acetate (PubChem CID 615156) has the molecular formula C12H6Cl2N2O4 and a molecular weight of 313.10 g/mol. Its IUPAC name is (4-acetyloxy-2,3-dichloro-5,6-dicyanophenyl) acetate.
| Compound Name | (4-acetyloxy-2,3-dichloro-5,6-dicyanophenyl) acetate |
|---|---|
| PubChem CID | 615156 |
| Molecular Formula | C12H6Cl2N2O4 |
| Molecular Weight | 313.10 g/mol |
| Exact Mass | 311.97 |
| IUPAC Name | (4-acetyloxy-2,3-dichloro-5,6-dicyanophenyl) acetate |
| SMILES | CC(=O)Oc1c(Cl)c(Cl)c(OC(C)=O)c(C#N)c1C#N |
| InChI | InChI=1S/C12H6Cl2N2O4/c1-5(17)19-11-7(3-15)8(4-16)12(20-6(2)18)10(14)9(11)13/h1-2H3 |
| InChIKey | HZOYRHAKLMONMZ-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.10 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|