C20H20ClN3O6 — CID 6218988
3-[(Z)-(3-chloro-4-ethoxy-5-methoxyphenyl)methylideneamino]-6,7-dimethoxy-1H-quinazoline-2,4-dione (PubChem CID 6218988) has the molecular formula C20H20ClN3O6 and a molecular weight of 433.85 g/mol. Its IUPAC name is 3-[(Z)-(3-chloro-4-ethoxy-5-methoxyphenyl)methylideneamino]-6,7-dimethoxy-1H-quinazoline-2,4-dione.
| Compound Name | 3-[(Z)-(3-chloro-4-ethoxy-5-methoxyphenyl)methylideneamino]-6,7-dimethoxy-1H-quinazoline-2,4-dione |
|---|---|
| PubChem CID | 6218988 |
| Molecular Formula | C20H20ClN3O6 |
| Molecular Weight | 433.85 g/mol |
| Exact Mass | 433.10 |
| IUPAC Name | 3-[(Z)-(3-chloro-4-ethoxy-5-methoxyphenyl)methylideneamino]-6,7-dimethoxy-1H-quinazoline-2,4-dione |
| SMILES | CCOc1c(Cl)cc(/C=N\n2c(=O)[nH]c3cc(OC)c(OC)cc3c2=O)cc1OC |
| InChI | InChI=1S/C20H20ClN3O6/c1-5-30-18-13(21)6-11(7-17(18)29-4)10-22-24-19(25)12-8-15(27-2)16(28-3)9-14(12)23-20(24)26/h6-10H,5H2,1-4H3,(H,23,26)/b22-10- |
| InChIKey | DIVHYRCAGDHDMQ-YVNNLAQVSA-N |
| XLogP | 2.65 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.85 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|