C24H24FNO6S2 — CID 6262452
[3-[[2-methoxyethyl-[(E)-2-phenylethenyl]sulfonylamino]methyl]phenyl] 4-fluorobenzenesulfonate (PubChem CID 6262452) has the molecular formula C24H24FNO6S2 and a molecular weight of 505.59 g/mol. Its IUPAC name is [3-[[2-methoxyethyl-[(E)-2-phenylethenyl]sulfonylamino]methyl]phenyl] 4-fluorobenzenesulfonate.
| Compound Name | [3-[[2-methoxyethyl-[(E)-2-phenylethenyl]sulfonylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
|---|---|
| PubChem CID | 6262452 |
| Molecular Formula | C24H24FNO6S2 |
| Molecular Weight | 505.59 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | [3-[[2-methoxyethyl-[(E)-2-phenylethenyl]sulfonylamino]methyl]phenyl] 4-fluorobenzenesulfonate |
| SMILES | COCCN(Cc1cccc(OS(=O)(=O)c2ccc(F)cc2)c1)S(=O)(=O)/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H24FNO6S2/c1-31-16-15-26(33(27,28)17-14-20-6-3-2-4-7-20)19-21-8-5-9-23(18-21)32-34(29,30)24-12-10-22(25)11-13-24/h2-14,17-18H,15-16,19H2,1H3/b17-14+ |
| InChIKey | PMKNQEPQIMGQIM-SAPNQHFASA-N |
| XLogP | 4.04 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.59 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|