C12H14N4OS — CID 63002325
1-(4-amino-1,3-benzothiazol-5-yl)-1,4-diazepan-5-one (PubChem CID 63002325) has the molecular formula C12H14N4OS and a molecular weight of 262.34 g/mol. Its IUPAC name is 1-(4-amino-1,3-benzothiazol-5-yl)-1,4-diazepan-5-one.
| Compound Name | 1-(4-amino-1,3-benzothiazol-5-yl)-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 63002325 |
| Molecular Formula | C12H14N4OS |
| Molecular Weight | 262.34 g/mol |
| Exact Mass | 262.09 |
| IUPAC Name | 1-(4-amino-1,3-benzothiazol-5-yl)-1,4-diazepan-5-one |
| SMILES | Nc1c(N2CCNC(=O)CC2)ccc2scnc12 |
| InChI | InChI=1S/C12H14N4OS/c13-11-8(1-2-9-12(11)15-7-18-9)16-5-3-10(17)14-4-6-16/h1-2,7H,3-6,13H2,(H,14,17) |
| InChIKey | YQVSCKKYIPQADW-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.34 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|