C12H17FN2 — CID 63176690
N-(4-fluorophenyl)-N,2,2-trimethylpropanimidamide (PubChem CID 63176690) has the molecular formula C12H17FN2 and a molecular weight of 208.28 g/mol. Its IUPAC name is N-(4-fluorophenyl)-N,2,2-trimethylpropanimidamide.
| Compound Name | N-(4-fluorophenyl)-N,2,2-trimethylpropanimidamide |
|---|---|
| PubChem CID | 63176690 |
| Molecular Formula | C12H17FN2 |
| Molecular Weight | 208.28 g/mol |
| Exact Mass | 208.14 |
| IUPAC Name | N-(4-fluorophenyl)-N,2,2-trimethylpropanimidamide |
| SMILES | [H]/N=C(/N(C)c1ccc(F)cc1)C(C)(C)C |
| InChI | InChI=1S/C12H17FN2/c1-12(2,3)11(14)15(4)10-7-5-9(13)6-8-10/h5-8,14H,1-4H3/b14-11+ |
| InChIKey | DETMSMISQQVBFJ-SDNWHVSQSA-N |
| XLogP | 3.29 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.28 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|