C31H26N2O5 — CID 6357374
[4-[(1S,11S,12R,16S)-14-(2,4-dimethylphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonyl]phenyl] acetate (PubChem CID 6357374) has the molecular formula C31H26N2O5 and a molecular weight of 506.56 g/mol. Its IUPAC name is [4-[(1S,11S,12R,16S)-14-(2,4-dimethylphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonyl]phenyl] acetate.
| Compound Name | [4-[(1S,11S,12R,16S)-14-(2,4-dimethylphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonyl]phenyl] acetate |
|---|---|
| PubChem CID | 6357374 |
| Molecular Formula | C31H26N2O5 |
| Molecular Weight | 506.56 g/mol |
| Exact Mass | 506.18 |
| IUPAC Name | [4-[(1S,11S,12R,16S)-14-(2,4-dimethylphenyl)-13,15-dioxo-10,14-diazatetracyclo[8.6.0.02,7.012,16]hexadeca-2,4,6,8-tetraene-11-carbonyl]phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(C(=O)[C@@H]2[C@@H]3C(=O)N(c4ccc(C)cc4C)C(=O)[C@@H]3[C@H]3c4ccccc4C=CN23)cc1 |
| InChI | InChI=1S/C31H26N2O5/c1-17-8-13-24(18(2)16-17)33-30(36)25-26(31(33)37)28(29(35)21-9-11-22(12-10-21)38-19(3)34)32-15-14-20-6-4-5-7-23(20)27(25)32/h4-16,25-28H,1-3H3/t25-,26+,27+,28-/m0/s1 |
| InChIKey | BJCWPAGBQNKERY-HFLBTKGNSA-N |
| XLogP | 4.63 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.56 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|