C12H16F3N3OS — CID 63826950
N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine (PubChem CID 63826950) has the molecular formula C12H16F3N3OS and a molecular weight of 307.34 g/mol. Its IUPAC name is N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine.
| Compound Name | N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
|---|---|
| PubChem CID | 63826950 |
| Molecular Formula | C12H16F3N3OS |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | N-[(3,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-(2,2,2-trifluoroethoxy)ethanamine |
| SMILES | Cc1nc2scc(C)n2c1CNCCOCC(F)(F)F |
| InChI | InChI=1S/C12H16F3N3OS/c1-8-6-20-11-17-9(2)10(18(8)11)5-16-3-4-19-7-12(13,14)15/h6,16H,3-5,7H2,1-2H3 |
| InChIKey | GGOQFHXIBUBKJF-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|