C6H12F3NO3S — CID 63900449
1,1,1-trifluoro-3-(2-methylsulfonylethylamino)propan-2-ol (PubChem CID 63900449) has the molecular formula C6H12F3NO3S and a molecular weight of 235.23 g/mol. Its IUPAC name is 1,1,1-trifluoro-3-(2-methylsulfonylethylamino)propan-2-ol.
| Compound Name | 1,1,1-trifluoro-3-(2-methylsulfonylethylamino)propan-2-ol |
|---|---|
| PubChem CID | 63900449 |
| Molecular Formula | C6H12F3NO3S |
| Molecular Weight | 235.23 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 1,1,1-trifluoro-3-(2-methylsulfonylethylamino)propan-2-ol |
| SMILES | CS(=O)(=O)CCNCC(O)C(F)(F)F |
| InChI | InChI=1S/C6H12F3NO3S/c1-14(12,13)3-2-10-4-5(11)6(7,8)9/h5,10-11H,2-4H2,1H3 |
| InChIKey | CHPKJTJFOXKEGT-UHFFFAOYSA-N |
| XLogP | -0.46 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.23 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|