C43H42O2 — CID 6475707
(3aR,6aR)-4,4,6,6-tetrakis[(E)-3-phenylprop-2-enyl]-1,3,3a,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 6475707) has the molecular formula C43H42O2 and a molecular weight of 590.81 g/mol. Its IUPAC name is (3aR,6aR)-4,4,6,6-tetrakis[(E)-3-phenylprop-2-enyl]-1,3,3a,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | (3aR,6aR)-4,4,6,6-tetrakis[(E)-3-phenylprop-2-enyl]-1,3,3a,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 6475707 |
| Molecular Formula | C43H42O2 |
| Molecular Weight | 590.81 g/mol |
| Exact Mass | 590.32 |
| IUPAC Name | (3aR,6aR)-4,4,6,6-tetrakis[(E)-3-phenylprop-2-enyl]-1,3,3a,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | O=C1C(C/C=C/c2ccccc2)(C/C=C/c2ccccc2)[C@@H]2COC[C@H]2C1(C/C=C/c1ccccc1)C/C=C/c1ccccc1 |
| InChI | InChI=1S/C43H42O2/c44-41-42(29-13-25-35-17-5-1-6-18-35,30-14-26-36-19-7-2-8-20-36)39-33-45-34-40(39)43(41,31-15-27-37-21-9-3-10-22-37)32-16-28-38-23-11-4-12-24-38/h1-28,39-40H,29-34H2/b25-13+,26-14+,27-15+,28-16+/t39-,40-/m1/s1 |
| InChIKey | MAXPJTVHCQBQQE-VOHUHAEWSA-N |
| XLogP | 10.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.81 |
| LogP ≤ 5 | 10.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |