C39H38O2 — CID 6475708
(3aR,4S,6S,6aR)-4,6-dibenzyl-4,6-bis[(E)-3-phenylprop-2-enyl]-1,3,3a,6a-tetrahydrocyclopenta[c]furan-5-one (PubChem CID 6475708) has the molecular formula C39H38O2 and a molecular weight of 538.73 g/mol. Its IUPAC name is (3aR,4S,6S,6aR)-4,6-dibenzyl-4,6-bis[(E)-3-phenylprop-2-enyl]-1,3,3a,6a-tetrahydrocyclopenta[c]furan-5-one.
| Compound Name | (3aR,4S,6S,6aR)-4,6-dibenzyl-4,6-bis[(E)-3-phenylprop-2-enyl]-1,3,3a,6a-tetrahydrocyclopenta[c]furan-5-one |
|---|---|
| PubChem CID | 6475708 |
| Molecular Formula | C39H38O2 |
| Molecular Weight | 538.73 g/mol |
| Exact Mass | 538.29 |
| IUPAC Name | (3aR,4S,6S,6aR)-4,6-dibenzyl-4,6-bis[(E)-3-phenylprop-2-enyl]-1,3,3a,6a-tetrahydrocyclopenta[c]furan-5-one |
| SMILES | O=C1[C@@](C/C=C/c2ccccc2)(Cc2ccccc2)[C@@H]2COC[C@H]2[C@]1(C/C=C/c1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C39H38O2/c40-37-38(27-33-19-9-3-10-20-33,25-13-23-31-15-5-1-6-16-31)35-29-41-30-36(35)39(37,28-34-21-11-4-12-22-34)26-14-24-32-17-7-2-8-18-32/h1-24,35-36H,25-30H2/b23-13+,24-14+/t35-,36-,38+,39+/m1/s1 |
| InChIKey | QMPXMGHJTSIOGM-JBLITATRSA-N |
| XLogP | 8.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.73 |
| LogP ≤ 5 | 8.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |