C11H17ClO3S2 — CID 65012708
2-(thiophen-2-ylmethoxymethyl)pentane-1-sulfonyl chloride (PubChem CID 65012708) has the molecular formula C11H17ClO3S2 and a molecular weight of 296.84 g/mol. Its IUPAC name is 2-(thiophen-2-ylmethoxymethyl)pentane-1-sulfonyl chloride.
| Compound Name | 2-(thiophen-2-ylmethoxymethyl)pentane-1-sulfonyl chloride |
|---|---|
| PubChem CID | 65012708 |
| Molecular Formula | C11H17ClO3S2 |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | 2-(thiophen-2-ylmethoxymethyl)pentane-1-sulfonyl chloride |
| SMILES | CCCC(COCc1cccs1)CS(=O)(=O)Cl |
| InChI | InChI=1S/C11H17ClO3S2/c1-2-4-10(9-17(12,13)14)7-15-8-11-5-3-6-16-11/h3,5-6,10H,2,4,7-9H2,1H3 |
| InChIKey | RPCUSWYMBAJWHI-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |