C17H26N2O2 — CID 65461111
1-[4-(1,3-benzodioxol-5-yl)butan-2-yl]-2,2-dimethylpiperazine (PubChem CID 65461111) has the molecular formula C17H26N2O2 and a molecular weight of 290.41 g/mol. Its IUPAC name is 1-[4-(1,3-benzodioxol-5-yl)butan-2-yl]-2,2-dimethylpiperazine.
| Compound Name | 1-[4-(1,3-benzodioxol-5-yl)butan-2-yl]-2,2-dimethylpiperazine |
|---|---|
| PubChem CID | 65461111 |
| Molecular Formula | C17H26N2O2 |
| Molecular Weight | 290.41 g/mol |
| Exact Mass | 290.20 |
| IUPAC Name | 1-[4-(1,3-benzodioxol-5-yl)butan-2-yl]-2,2-dimethylpiperazine |
| SMILES | CC(CCc1ccc2c(c1)OCO2)N1CCNCC1(C)C |
| InChI | InChI=1S/C17H26N2O2/c1-13(19-9-8-18-11-17(19,2)3)4-5-14-6-7-15-16(10-14)21-12-20-15/h6-7,10,13,18H,4-5,8-9,11-12H2,1-3H3 |
| InChIKey | JPOXKTXBXLBJJM-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |