C20H34BrN2O2+ — CID 6563715
(1R,2R,4S)-2-bromo-4,7,7-trimethyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)bicyclo[2.2.1]heptane-1-carboxamide (PubChem CID 6563715) has the molecular formula C20H34BrN2O2+ and a molecular weight of 414.41 g/mol. Its IUPAC name is (1R,2R,4S)-2-bromo-4,7,7-trimethyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)bicyclo[2.2.1]heptane-1-carboxamide.
| Compound Name | (1R,2R,4S)-2-bromo-4,7,7-trimethyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)bicyclo[2.2.1]heptane-1-carboxamide |
|---|---|
| PubChem CID | 6563715 |
| Molecular Formula | C20H34BrN2O2+ |
| Molecular Weight | 414.41 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (1R,2R,4S)-2-bromo-4,7,7-trimethyl-3-oxo-N-(2,2,6,6-tetramethylpiperidin-1-ium-4-yl)bicyclo[2.2.1]heptane-1-carboxamide |
| SMILES | CC1(C)CC(NC(=O)[C@]23CC[C@](C)(C(=O)[C@@H]2Br)C3(C)C)CC(C)(C)[NH2+]1 |
| InChI | InChI=1S/C20H33BrN2O2/c1-16(2)10-12(11-17(3,4)23-16)22-15(25)20-9-8-19(7,18(20,5)6)14(24)13(20)21/h12-13,23H,8-11H2,1-7H3,(H,22,25)/p+1/t13-,19+,20-/m0/s1 |
| InChIKey | GAGYRXAMCCECTP-SVIJTADQSA-O |
| XLogP | 2.54 |
| TPSA | 62.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.41 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|