C13H14FIN2OS — CID 66100170
5-fluoro-6-iodo-3-(2-methoxycyclopentyl)-1H-benzimidazole-2-thione (PubChem CID 66100170) has the molecular formula C13H14FIN2OS and a molecular weight of 392.24 g/mol. Its IUPAC name is 5-fluoro-6-iodo-3-(2-methoxycyclopentyl)-1H-benzimidazole-2-thione.
| Compound Name | 5-fluoro-6-iodo-3-(2-methoxycyclopentyl)-1H-benzimidazole-2-thione |
|---|---|
| PubChem CID | 66100170 |
| Molecular Formula | C13H14FIN2OS |
| Molecular Weight | 392.24 g/mol |
| Exact Mass | 391.99 |
| IUPAC Name | 5-fluoro-6-iodo-3-(2-methoxycyclopentyl)-1H-benzimidazole-2-thione |
| SMILES | COC1CCCC1n1c(=S)[nH]c2cc(I)c(F)cc21 |
| InChI | InChI=1S/C13H14FIN2OS/c1-18-12-4-2-3-10(12)17-11-5-7(14)8(15)6-9(11)16-13(17)19/h5-6,10,12H,2-4H2,1H3,(H,16,19) |
| InChIKey | MAWTVSBWMAZVRK-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 29.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.24 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|