C11H15F3N2O3 — CID 66329932
5-ethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione (PubChem CID 66329932) has the molecular formula C11H15F3N2O3 and a molecular weight of 280.25 g/mol. Its IUPAC name is 5-ethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione.
| Compound Name | 5-ethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 66329932 |
| Molecular Formula | C11H15F3N2O3 |
| Molecular Weight | 280.25 g/mol |
| Exact Mass | 280.10 |
| IUPAC Name | 5-ethyl-1-[3-(2,2,2-trifluoroethoxy)propyl]pyrimidine-2,4-dione |
| SMILES | CCc1cn(CCCOCC(F)(F)F)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15F3N2O3/c1-2-8-6-16(10(18)15-9(8)17)4-3-5-19-7-11(12,13)14/h6H,2-5,7H2,1H3,(H,15,17,18) |
| InChIKey | MDYBFIQPHVQXMM-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 64.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.25 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|