C10H20N2O2S2 — CID 66381738
2,2-dimethyl-1-(3-methylsulfonylthiomorpholin-4-yl)propan-1-imine (PubChem CID 66381738) has the molecular formula C10H20N2O2S2 and a molecular weight of 264.42 g/mol. Its IUPAC name is 2,2-dimethyl-1-(3-methylsulfonylthiomorpholin-4-yl)propan-1-imine.
| Compound Name | 2,2-dimethyl-1-(3-methylsulfonylthiomorpholin-4-yl)propan-1-imine |
|---|---|
| PubChem CID | 66381738 |
| Molecular Formula | C10H20N2O2S2 |
| Molecular Weight | 264.42 g/mol |
| Exact Mass | 264.10 |
| IUPAC Name | 2,2-dimethyl-1-(3-methylsulfonylthiomorpholin-4-yl)propan-1-imine |
| SMILES | [H]/N=C(/N1CCSCC1S(C)(=O)=O)C(C)(C)C |
| InChI | InChI=1S/C10H20N2O2S2/c1-10(2,3)9(11)12-5-6-15-7-8(12)16(4,13)14/h8,11H,5-7H2,1-4H3/b11-9+ |
| InChIKey | QYPLSEQWADFKIW-PKNBQFBNSA-N |
| XLogP | 1.43 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.42 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|