C14H7Br2ClN2O3 — CID 66556918
(2Z)-6-chloro-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-4H-pyrido[3,2-b][1,4]oxazin-3-one (PubChem CID 66556918) has the molecular formula C14H7Br2ClN2O3 and a molecular weight of 446.48 g/mol. Its IUPAC name is (2Z)-6-chloro-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-4H-pyrido[3,2-b][1,4]oxazin-3-one.
| Compound Name | (2Z)-6-chloro-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
|---|---|
| PubChem CID | 66556918 |
| Molecular Formula | C14H7Br2ClN2O3 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 443.85 |
| IUPAC Name | (2Z)-6-chloro-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]-4H-pyrido[3,2-b][1,4]oxazin-3-one |
| SMILES | O=C1Nc2nc(Cl)ccc2O/C1=C\c1cc(Br)c(O)c(Br)c1 |
| InChI | InChI=1S/C14H7Br2ClN2O3/c15-7-3-6(4-8(16)12(7)20)5-10-14(21)19-13-9(22-10)1-2-11(17)18-13/h1-5,20H,(H,18,19,21)/b10-5- |
| InChIKey | GJLURRGPXPCRNA-YHYXMXQVSA-N |
| XLogP | 4.34 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|