C21H26ClNO4S — CID 66588849
[3-(3,4-dimethyl-9,10-dioxothioxanthen-2-yl)oxy-2-hydroxypropyl]-trimethylazanium chloride (PubChem CID 66588849) has the molecular formula C21H26ClNO4S and a molecular weight of 423.96 g/mol. Its IUPAC name is [3-(3,4-dimethyl-9,10-dioxothioxanthen-2-yl)oxy-2-hydroxypropyl]-trimethylazanium chloride.
| Compound Name | [3-(3,4-dimethyl-9,10-dioxothioxanthen-2-yl)oxy-2-hydroxypropyl]-trimethylazanium chloride |
|---|---|
| PubChem CID | 66588849 |
| Molecular Formula | C21H26ClNO4S |
| Molecular Weight | 423.96 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | [3-(3,4-dimethyl-9,10-dioxothioxanthen-2-yl)oxy-2-hydroxypropyl]-trimethylazanium chloride |
| SMILES | Cc1c(OCC(O)C[N+](C)(C)C)cc2c(c1C)S(=O)c1ccccc1C2=O.[Cl-] |
| InChI | InChI=1S/C21H26NO4S.ClH/c1-13-14(2)21-17(10-18(13)26-12-15(23)11-22(3,4)5)20(24)16-8-6-7-9-19(16)27(21)25;/h6-10,15,23H,11-12H2,1-5H3;1H/q+1;/p-1 |
| InChIKey | FAZTWFGIXGHEPX-UHFFFAOYSA-M |
| XLogP | -0.54 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.96 |
| LogP ≤ 5 | -0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|