C22H30NO3S+ — CID 89198370
[3-[2-[(1Z)-buta-1,3-dienyl]-3,7,8-trimethyl-4-oxothiochromen-6-yl]oxy-2-hydroxypropyl]-trimethylazanium (PubChem CID 89198370) has the molecular formula C22H30NO3S+ and a molecular weight of 388.55 g/mol. Its IUPAC name is [3-[2-[(1Z)-buta-1,3-dienyl]-3,7,8-trimethyl-4-oxothiochromen-6-yl]oxy-2-hydroxypropyl]-trimethylazanium.
| Compound Name | [3-[2-[(1Z)-buta-1,3-dienyl]-3,7,8-trimethyl-4-oxothiochromen-6-yl]oxy-2-hydroxypropyl]-trimethylazanium |
|---|---|
| PubChem CID | 89198370 |
| Molecular Formula | C22H30NO3S+ |
| Molecular Weight | 388.55 g/mol |
| Exact Mass | 388.19 |
| IUPAC Name | [3-[2-[(1Z)-buta-1,3-dienyl]-3,7,8-trimethyl-4-oxothiochromen-6-yl]oxy-2-hydroxypropyl]-trimethylazanium |
| SMILES | C=C/C=C\c1sc2c(C)c(C)c(OCC(O)C[N+](C)(C)C)cc2c(=O)c1C |
| InChI | InChI=1S/C22H30NO3S/c1-8-9-10-20-16(4)21(25)18-11-19(14(2)15(3)22(18)27-20)26-13-17(24)12-23(5,6)7/h8-11,17,24H,1,12-13H2,2-7H3/q+1/b10-9- |
| InChIKey | YUDMLRNIFIBUJB-KTKRTIGZSA-N |
| XLogP | 3.83 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.55 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|