C45H30N4O — CID 66709207
2-methoxy-3,5,7,8-tetraphenylporphyrin (PubChem CID 66709207) has the molecular formula C45H30N4O and a molecular weight of 642.76 g/mol. Its IUPAC name is 2-methoxy-3,5,7,8-tetraphenylporphyrin.
| Compound Name | 2-methoxy-3,5,7,8-tetraphenylporphyrin |
|---|---|
| PubChem CID | 66709207 |
| Molecular Formula | C45H30N4O |
| Molecular Weight | 642.76 g/mol |
| Exact Mass | 642.24 |
| IUPAC Name | 2-methoxy-3,5,7,8-tetraphenylporphyrin |
| SMILES | COC1=C(c2ccccc2)/C2=C(\c3ccccc3)C3=N/C(=C\C4=N/C(=C\C5=N/C(=C\C1=N2)C=C5)C=C4)C(c1ccccc1)=C3c1ccccc1 |
| InChI | InChI=1S/C45H30N4O/c1-50-45-38-28-36-25-23-34(47-36)26-33-22-24-35(46-33)27-37-39(29-14-6-2-7-15-29)40(30-16-8-3-9-17-30)43(48-37)41(31-18-10-4-11-19-31)44(49-38)42(45)32-20-12-5-13-21-32/h2-28H,1H3/b33-26-,34-26-,35-27-,36-28-,37-27-,38-28-,43-41-,44-41- |
| InChIKey | GYMXTEMHPIJRRH-RJOPRPFDSA-N |
| XLogP | 9.66 |
| TPSA | 58.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.76 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|