C24H42N6O5Si2 — CID 66805064
9-[(1R,8R,14R)-11-methyl-4,4,6,6-tetra(propan-2-yl)-3,5,7,10,13-pentaoxa-11-aza-4,6-disilatricyclo[7.3.2.01,8]tetradecan-14-yl]purin-6-amine (PubChem CID 66805064) has the molecular formula C24H42N6O5Si2 and a molecular weight of 550.81 g/mol. Its IUPAC name is 9-[(1R,8R,14R)-11-methyl-4,4,6,6-tetra(propan-2-yl)-3,5,7,10,13-pentaoxa-11-aza-4,6-disilatricyclo[7.3.2.01,8]tetradecan-14-yl]purin-6-amine.
| Compound Name | 9-[(1R,8R,14R)-11-methyl-4,4,6,6-tetra(propan-2-yl)-3,5,7,10,13-pentaoxa-11-aza-4,6-disilatricyclo[7.3.2.01,8]tetradecan-14-yl]purin-6-amine |
|---|---|
| PubChem CID | 66805064 |
| Molecular Formula | C24H42N6O5Si2 |
| Molecular Weight | 550.81 g/mol |
| Exact Mass | 550.28 |
| IUPAC Name | 9-[(1R,8R,14R)-11-methyl-4,4,6,6-tetra(propan-2-yl)-3,5,7,10,13-pentaoxa-11-aza-4,6-disilatricyclo[7.3.2.01,8]tetradecan-14-yl]purin-6-amine |
| SMILES | CC(C)[Si]1(C(C)C)OC[C@@]23CN(C)OC([C@H](n4cnc5c(N)ncnc54)O2)[C@H]3O[Si](C(C)C)(C(C)C)O1 |
| InChI | InChI=1S/C24H42N6O5Si2/c1-14(2)36(15(3)4)31-11-24-10-29(9)33-19(20(24)34-37(35-36,16(5)6)17(7)8)23(32-24)30-13-28-18-21(25)26-12-27-22(18)30/h12-17,19-20,23H,10-11H2,1-9H3,(H2,25,26,27)/t19?,20-,23-,24-/m1/s1 |
| InChIKey | PMCKYUGSGPBKEN-MWESFCAISA-N |
| XLogP | 3.88 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.81 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|