C28H25N5 — CID 66805723
3-cyclobutylimino-N-(6-methyl-3-pyridinyl)-5-phenylphenazin-2-amine (PubChem CID 66805723) has the molecular formula C28H25N5 and a molecular weight of 431.54 g/mol. Its IUPAC name is 3-cyclobutylimino-N-(6-methyl-3-pyridinyl)-5-phenylphenazin-2-amine.
| Compound Name | 3-cyclobutylimino-N-(6-methyl-3-pyridinyl)-5-phenylphenazin-2-amine |
|---|---|
| PubChem CID | 66805723 |
| Molecular Formula | C28H25N5 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.21 |
| IUPAC Name | 3-cyclobutylimino-N-(6-methyl-3-pyridinyl)-5-phenylphenazin-2-amine |
| SMILES | Cc1ccc(Nc2cc3nc4ccccc4n(-c4ccccc4)c-3c/c2=N\C2CCC2)cn1 |
| InChI | InChI=1S/C28H25N5/c1-19-14-15-21(18-29-19)31-24-16-26-28(17-25(24)30-20-8-7-9-20)33(22-10-3-2-4-11-22)27-13-6-5-12-23(27)32-26/h2-6,10-18,20,31H,7-9H2,1H3/b30-25+ |
| InChIKey | BDTQEBYYPFPJCN-QCWLDUFUSA-N |
| XLogP | 6.03 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|