C27H23N5 — CID 66805717
3-cyclopropylimino-N-(5-methyl-3-pyridinyl)-5-phenylphenazin-2-amine (PubChem CID 66805717) has the molecular formula C27H23N5 and a molecular weight of 417.52 g/mol. Its IUPAC name is 3-cyclopropylimino-N-(5-methyl-3-pyridinyl)-5-phenylphenazin-2-amine.
| Compound Name | 3-cyclopropylimino-N-(5-methyl-3-pyridinyl)-5-phenylphenazin-2-amine |
|---|---|
| PubChem CID | 66805717 |
| Molecular Formula | C27H23N5 |
| Molecular Weight | 417.52 g/mol |
| Exact Mass | 417.20 |
| IUPAC Name | 3-cyclopropylimino-N-(5-methyl-3-pyridinyl)-5-phenylphenazin-2-amine |
| SMILES | Cc1cncc(Nc2cc3nc4ccccc4n(-c4ccccc4)c-3c/c2=N\C2CC2)c1 |
| InChI | InChI=1S/C27H23N5/c1-18-13-20(17-28-16-18)30-23-14-25-27(15-24(23)29-19-11-12-19)32(21-7-3-2-4-8-21)26-10-6-5-9-22(26)31-25/h2-10,13-17,19,30H,11-12H2,1H3/b29-24+ |
| InChIKey | AAHNACLEXJSYHA-RMLRFSFXSA-N |
| XLogP | 5.64 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.52 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|