C31H33N5O — CID 68624704
5-cyclohexa-1,3-dien-1-yl-3-(4-methoxycyclohexyl)imino-N-(5-methyl-3-pyridinyl)phenazin-2-amine (PubChem CID 68624704) has the molecular formula C31H33N5O and a molecular weight of 491.64 g/mol. Its IUPAC name is 5-cyclohexa-1,3-dien-1-yl-3-(4-methoxycyclohexyl)imino-N-(5-methyl-3-pyridinyl)phenazin-2-amine.
| Compound Name | 5-cyclohexa-1,3-dien-1-yl-3-(4-methoxycyclohexyl)imino-N-(5-methyl-3-pyridinyl)phenazin-2-amine |
|---|---|
| PubChem CID | 68624704 |
| Molecular Formula | C31H33N5O |
| Molecular Weight | 491.64 g/mol |
| Exact Mass | 491.27 |
| IUPAC Name | 5-cyclohexa-1,3-dien-1-yl-3-(4-methoxycyclohexyl)imino-N-(5-methyl-3-pyridinyl)phenazin-2-amine |
| SMILES | COC1CCC(/N=c2\cc3n(C4=CC=CCC4)c4ccccc4nc-3cc2Nc2cncc(C)c2)CC1 |
| InChI | InChI=1S/C31H33N5O/c1-21-16-23(20-32-19-21)34-27-17-29-31(18-28(27)33-22-12-14-25(37-2)15-13-22)36(24-8-4-3-5-9-24)30-11-7-6-10-26(30)35-29/h3-4,6-8,10-11,16-20,22,25,34H,5,9,12-15H2,1-2H3/b33-28+ |
| InChIKey | DLDFJJIIAKGYRH-PJJLUWSFSA-N |
| XLogP | 6.64 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.64 |
| LogP ≤ 5 | 6.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|