C27H22N4 — CID 56612122
3-cyclopropylimino-N,5-diphenylphenazin-2-amine (PubChem CID 56612122) has the molecular formula C27H22N4 and a molecular weight of 402.50 g/mol. Its IUPAC name is 3-cyclopropylimino-N,5-diphenylphenazin-2-amine.
| Compound Name | 3-cyclopropylimino-N,5-diphenylphenazin-2-amine |
|---|---|
| PubChem CID | 56612122 |
| Molecular Formula | C27H22N4 |
| Molecular Weight | 402.50 g/mol |
| Exact Mass | 402.18 |
| IUPAC Name | 3-cyclopropylimino-N,5-diphenylphenazin-2-amine |
| SMILES | c1ccc(Nc2cc3nc4ccccc4n(-c4ccccc4)c-3c/c2=N\C2CC2)cc1 |
| InChI | InChI=1S/C27H22N4/c1-3-9-19(10-4-1)28-23-17-25-27(18-24(23)29-20-15-16-20)31(21-11-5-2-6-12-21)26-14-8-7-13-22(26)30-25/h1-14,17-18,20,28H,15-16H2/b29-24+ |
| InChIKey | FDTYYLPMOLXRTC-RMLRFSFXSA-N |
| XLogP | 5.94 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.50 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|