C29H25F2N5 — CID 66805824
3-cyclohexylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine (PubChem CID 66805824) has the molecular formula C29H25F2N5 and a molecular weight of 481.55 g/mol. Its IUPAC name is 3-cyclohexylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine.
| Compound Name | 3-cyclohexylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine |
|---|---|
| PubChem CID | 66805824 |
| Molecular Formula | C29H25F2N5 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.21 |
| IUPAC Name | 3-cyclohexylimino-5-(3,4-difluorophenyl)-N-pyridin-3-ylphenazin-2-amine |
| SMILES | Fc1ccc(-n2c3c/c(=N\C4CCCCC4)c(Nc4cccnc4)cc-3nc3ccccc32)cc1F |
| InChI | InChI=1S/C29H25F2N5/c30-22-13-12-21(15-23(22)31)36-28-11-5-4-10-24(28)35-27-16-25(34-20-9-6-14-32-18-20)26(17-29(27)36)33-19-7-2-1-3-8-19/h4-6,9-19,34H,1-3,7-8H2/b33-26+ |
| InChIKey | CFHPIMLWTFPVJC-MHTZHOPKSA-N |
| XLogP | 6.78 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|