C28H25F2N5O2 — CID 140578172
(3E)-5-(3,4-difluorophenyl)-3-(1,2-dimethoxypropan-2-ylimino)-N-pyridin-3-ylphenazin-2-amine (PubChem CID 140578172) has the molecular formula C28H25F2N5O2 and a molecular weight of 501.54 g/mol. Its IUPAC name is (3E)-5-(3,4-difluorophenyl)-3-(1,2-dimethoxypropan-2-ylimino)-N-pyridin-3-ylphenazin-2-amine.
| Compound Name | (3E)-5-(3,4-difluorophenyl)-3-(1,2-dimethoxypropan-2-ylimino)-N-pyridin-3-ylphenazin-2-amine |
|---|---|
| PubChem CID | 140578172 |
| Molecular Formula | C28H25F2N5O2 |
| Molecular Weight | 501.54 g/mol |
| Exact Mass | 501.20 |
| IUPAC Name | (3E)-5-(3,4-difluorophenyl)-3-(1,2-dimethoxypropan-2-ylimino)-N-pyridin-3-ylphenazin-2-amine |
| SMILES | COCC(C)(/N=c1\cc2n(-c3ccc(F)c(F)c3)c3ccccc3nc-2cc1Nc1cccnc1)OC |
| InChI | InChI=1S/C28H25F2N5O2/c1-28(37-3,17-36-2)34-24-15-27-25(14-23(24)32-18-7-6-12-31-16-18)33-22-8-4-5-9-26(22)35(27)19-10-11-20(29)21(30)13-19/h4-16,32H,17H2,1-3H3/b34-24+ |
| InChIKey | JHJOPMARVBTPPJ-JGRMKTMXSA-N |
| XLogP | 5.46 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.54 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|