C25H20F2N6 — CID 66805882
5-(3,4-difluorophenyl)-3-propan-2-ylimino-N-pyrimidin-2-ylphenazin-2-amine (PubChem CID 66805882) has the molecular formula C25H20F2N6 and a molecular weight of 442.47 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-3-propan-2-ylimino-N-pyrimidin-2-ylphenazin-2-amine.
| Compound Name | 5-(3,4-difluorophenyl)-3-propan-2-ylimino-N-pyrimidin-2-ylphenazin-2-amine |
|---|---|
| PubChem CID | 66805882 |
| Molecular Formula | C25H20F2N6 |
| Molecular Weight | 442.47 g/mol |
| Exact Mass | 442.17 |
| IUPAC Name | 5-(3,4-difluorophenyl)-3-propan-2-ylimino-N-pyrimidin-2-ylphenazin-2-amine |
| SMILES | CC(C)/N=c1\cc2n(-c3ccc(F)c(F)c3)c3ccccc3nc-2cc1Nc1ncccn1 |
| InChI | InChI=1S/C25H20F2N6/c1-15(2)30-21-14-24-22(13-20(21)32-25-28-10-5-11-29-25)31-19-6-3-4-7-23(19)33(24)16-8-9-17(26)18(27)12-16/h3-15H,1-2H3,(H,28,29,32)/b30-21+ |
| InChIKey | ILTBUCMHEFHURJ-MWAVMZGNSA-N |
| XLogP | 5.25 |
| TPSA | 67.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.47 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|