C27H20Cl4N4 — CID 635889
N,5-bis(3,4-dichlorophenyl)-3-propan-2-yliminophenazin-2-amine (PubChem CID 635889) has the molecular formula C27H20Cl4N4 and a molecular weight of 542.30 g/mol. Its IUPAC name is N,5-bis(3,4-dichlorophenyl)-3-propan-2-yliminophenazin-2-amine.
| Compound Name | N,5-bis(3,4-dichlorophenyl)-3-propan-2-yliminophenazin-2-amine |
|---|---|
| PubChem CID | 635889 |
| Molecular Formula | C27H20Cl4N4 |
| Molecular Weight | 542.30 g/mol |
| Exact Mass | 540.04 |
| IUPAC Name | N,5-bis(3,4-dichlorophenyl)-3-propan-2-yliminophenazin-2-amine |
| SMILES | CC(C)/N=c1\cc2n(-c3ccc(Cl)c(Cl)c3)c3ccccc3nc-2cc1Nc1ccc(Cl)c(Cl)c1 |
| InChI | InChI=1S/C27H20Cl4N4/c1-15(2)32-24-14-27-25(13-23(24)33-16-7-9-18(28)20(30)11-16)34-22-5-3-4-6-26(22)35(27)17-8-10-19(29)21(31)12-17/h3-15,33H,1-2H3/b32-24+ |
| InChIKey | JUTNHNOKIAIJJF-FEZSWGLMSA-N |
| XLogP | 8.80 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.30 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|