About 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine
3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine (PubChem CID 66805850) has the molecular formula C27H21Cl2N5
and a molecular weight of 486.41 g/mol. Its IUPAC name is 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine.
Molecular Properties
| Compound Name | 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine |
| PubChem CID | 66805850 |
| Molecular Formula | C27H21Cl2N5 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine |
| SMILES | Cc1ncccc1Nc1cc2nc3ccccc3n(-c3ccc(Cl)c(Cl)c3)c-2c/c1=N\C1CC1 |
| InChI | InChI=1S/C27H21Cl2N5/c1-16-21(6-4-12-30-16)32-23-14-25-27(15-24(23)31-17-8-9-17)34(18-10-11-19(28)20(29)13-18)26-7-3-2-5-22(26)33-25/h2-7,10-15,17,32H,8-9H2,1H3/b31-24+ |
| InChIKey | UFFKRPNLXKOEDE-QFMPWRQOSA-N |
| XLogP | 6.95 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|
Analyze 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine?
The IUPAC name of 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine (CID 66805850) is 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine.
What is the SMILES notation for 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine?
The canonical SMILES for 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine is Cc1ncccc1Nc1cc2nc3ccccc3n(-c3ccc(Cl)c(Cl)c3)c-2c/c1=N\C1CC1.
What is the InChIKey of 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine?
The InChIKey is UFFKRPNLXKOEDE-QFMPWRQOSA-N. The full InChI is InChI=1S/C27H21Cl2N5/c1-16-21(6-4-12-30-16)32-23-14-25-27(15-24(23)31-17-8-9-17)34(18-10-11-19(28)20(29)13-18)26-7-3-2-5-22(26)33-25/h2-7,10-15,17,32H,8-9H2,1H3/b31-24+.
What are the key properties of 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine?
3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine has a molecular weight of 486.41 g/mol, XLogP of 6.95, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine is sourced from PubChem (CID 66805850), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).