C27H21Cl2N5 — CID 66805850
3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine (PubChem CID 66805850) has the molecular formula C27H21Cl2N5 and a molecular weight of 486.41 g/mol. Its IUPAC name is 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine.
| Compound Name | 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine |
|---|---|
| PubChem CID | 66805850 |
| Molecular Formula | C27H21Cl2N5 |
| Molecular Weight | 486.41 g/mol |
| Exact Mass | 485.12 |
| IUPAC Name | 3-cyclopropylimino-5-(3,4-dichlorophenyl)-N-(2-methyl-3-pyridinyl)phenazin-2-amine |
| SMILES | Cc1ncccc1Nc1cc2nc3ccccc3n(-c3ccc(Cl)c(Cl)c3)c-2c/c1=N\C1CC1 |
| InChI | InChI=1S/C27H21Cl2N5/c1-16-21(6-4-12-30-16)32-23-14-25-27(15-24(23)31-17-8-9-17)34(18-10-11-19(28)20(29)13-18)26-7-3-2-5-22(26)33-25/h2-7,10-15,17,32H,8-9H2,1H3/b31-24+ |
| InChIKey | UFFKRPNLXKOEDE-QFMPWRQOSA-N |
| XLogP | 6.95 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.41 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|