C32H30F3N5O2 — CID 66805582
3-(4-methoxycyclohexyl)imino-N-(2-methyl-3-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine (PubChem CID 66805582) has the molecular formula C32H30F3N5O2 and a molecular weight of 573.62 g/mol. Its IUPAC name is 3-(4-methoxycyclohexyl)imino-N-(2-methyl-3-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine.
| Compound Name | 3-(4-methoxycyclohexyl)imino-N-(2-methyl-3-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine |
|---|---|
| PubChem CID | 66805582 |
| Molecular Formula | C32H30F3N5O2 |
| Molecular Weight | 573.62 g/mol |
| Exact Mass | 573.24 |
| IUPAC Name | 3-(4-methoxycyclohexyl)imino-N-(2-methyl-3-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine |
| SMILES | COC1CCC(/N=c2\cc3n(-c4ccc(OC(F)(F)F)cc4)c4ccccc4nc-3cc2Nc2cccnc2C)CC1 |
| InChI | InChI=1S/C32H30F3N5O2/c1-20-25(7-5-17-36-20)38-27-18-29-31(19-28(27)37-21-9-13-23(41-2)14-10-21)40(30-8-4-3-6-26(30)39-29)22-11-15-24(16-12-22)42-32(33,34)35/h3-8,11-12,15-19,21,23,38H,9-10,13-14H2,1-2H3/b37-28+ |
| InChIKey | IRNNUOUFMJWIAT-PNFNHJRFSA-N |
| XLogP | 7.33 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 573.62 |
| LogP ≤ 5 | 7.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|