C31H29F3N6O2 — CID 66805968
N-(2-methyl-3-pyridinyl)-3-(2-morpholin-4-ylethylimino)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine (PubChem CID 66805968) has the molecular formula C31H29F3N6O2 and a molecular weight of 574.61 g/mol. Its IUPAC name is N-(2-methyl-3-pyridinyl)-3-(2-morpholin-4-ylethylimino)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine.
| Compound Name | N-(2-methyl-3-pyridinyl)-3-(2-morpholin-4-ylethylimino)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine |
|---|---|
| PubChem CID | 66805968 |
| Molecular Formula | C31H29F3N6O2 |
| Molecular Weight | 574.61 g/mol |
| Exact Mass | 574.23 |
| IUPAC Name | N-(2-methyl-3-pyridinyl)-3-(2-morpholin-4-ylethylimino)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine |
| SMILES | Cc1ncccc1Nc1cc2nc3ccccc3n(-c3ccc(OC(F)(F)F)cc3)c-2c/c1=N\CCN1CCOCC1 |
| InChI | InChI=1S/C31H29F3N6O2/c1-21-24(6-4-12-35-21)37-27-19-28-30(20-26(27)36-13-14-39-15-17-41-18-16-39)40(29-7-3-2-5-25(29)38-28)22-8-10-23(11-9-22)42-31(32,33)34/h2-12,19-20,37H,13-18H2,1H3/b36-26+ |
| InChIKey | YKZGLQBGADDULO-LZBRRTOVSA-N |
| XLogP | 5.71 |
| TPSA | 76.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.61 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|