C31H25F3N8O4 — CID 168874239
N-(2-methoxy-3-pyridinyl)-3-[2-(5-methyl-2-nitroimidazol-1-yl)ethylimino]-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine (PubChem CID 168874239) has the molecular formula C31H25F3N8O4 and a molecular weight of 630.59 g/mol. Its IUPAC name is N-(2-methoxy-3-pyridinyl)-3-[2-(5-methyl-2-nitroimidazol-1-yl)ethylimino]-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine.
| Compound Name | N-(2-methoxy-3-pyridinyl)-3-[2-(5-methyl-2-nitroimidazol-1-yl)ethylimino]-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine |
|---|---|
| PubChem CID | 168874239 |
| Molecular Formula | C31H25F3N8O4 |
| Molecular Weight | 630.59 g/mol |
| Exact Mass | 630.20 |
| IUPAC Name | N-(2-methoxy-3-pyridinyl)-3-[2-(5-methyl-2-nitroimidazol-1-yl)ethylimino]-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine |
| SMILES | COc1ncccc1Nc1cc2nc3ccccc3n(-c3ccc(OC(F)(F)F)cc3)c-2c/c1=N\CCn1c(C)cnc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H25F3N8O4/c1-19-18-37-30(42(43)44)40(19)15-14-35-24-17-28-26(16-25(24)39-23-7-5-13-36-29(23)45-2)38-22-6-3-4-8-27(22)41(28)20-9-11-21(12-10-20)46-31(32,33)34/h3-13,16-18,39H,14-15H2,1-2H3/b35-24+ |
| InChIKey | OHTIAZJRWNYPRF-JWHWKPFMSA-N |
| XLogP | 6.19 |
| TPSA | 134.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 46 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 630.59 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|