C27H23F2N5O — CID 66806289
5-(3,4-difluorophenyl)-N-(2-methoxy-3-pyridinyl)-3-propan-2-yliminophenazin-2-amine (PubChem CID 66806289) has the molecular formula C27H23F2N5O and a molecular weight of 471.51 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-N-(2-methoxy-3-pyridinyl)-3-propan-2-yliminophenazin-2-amine.
| Compound Name | 5-(3,4-difluorophenyl)-N-(2-methoxy-3-pyridinyl)-3-propan-2-yliminophenazin-2-amine |
|---|---|
| PubChem CID | 66806289 |
| Molecular Formula | C27H23F2N5O |
| Molecular Weight | 471.51 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | 5-(3,4-difluorophenyl)-N-(2-methoxy-3-pyridinyl)-3-propan-2-yliminophenazin-2-amine |
| SMILES | COc1ncccc1Nc1cc2nc3ccccc3n(-c3ccc(F)c(F)c3)c-2c/c1=N\C(C)C |
| InChI | InChI=1S/C27H23F2N5O/c1-16(2)31-23-15-26-24(14-22(23)33-21-8-6-12-30-27(21)35-3)32-20-7-4-5-9-25(20)34(26)17-10-11-18(28)19(29)13-17/h4-16,33H,1-3H3/b31-23+ |
| InChIKey | FPXJANGTAMLCTL-UQRQXUALSA-N |
| XLogP | 5.86 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.51 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|