C27H20Cl2FN5O — CID 66806287
3-cyclopropylimino-5-(3,4-dichlorophenyl)-7-fluoro-N-(2-methoxy-3-pyridinyl)phenazin-2-amine (PubChem CID 66806287) has the molecular formula C27H20Cl2FN5O and a molecular weight of 520.40 g/mol. Its IUPAC name is 3-cyclopropylimino-5-(3,4-dichlorophenyl)-7-fluoro-N-(2-methoxy-3-pyridinyl)phenazin-2-amine.
| Compound Name | 3-cyclopropylimino-5-(3,4-dichlorophenyl)-7-fluoro-N-(2-methoxy-3-pyridinyl)phenazin-2-amine |
|---|---|
| PubChem CID | 66806287 |
| Molecular Formula | C27H20Cl2FN5O |
| Molecular Weight | 520.40 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 3-cyclopropylimino-5-(3,4-dichlorophenyl)-7-fluoro-N-(2-methoxy-3-pyridinyl)phenazin-2-amine |
| SMILES | COc1ncccc1Nc1cc2nc3ccc(F)cc3n(-c3ccc(Cl)c(Cl)c3)c-2c/c1=N\C1CC1 |
| InChI | InChI=1S/C27H20Cl2FN5O/c1-36-27-21(3-2-10-31-27)34-22-13-24-26(14-23(22)32-16-5-6-16)35(17-7-8-18(28)19(29)12-17)25-11-15(30)4-9-20(25)33-24/h2-4,7-14,16,34H,5-6H2,1H3/b32-23+ |
| InChIKey | DVJHFEGGUAVVAW-AWSUPERCSA-N |
| XLogP | 6.79 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.40 |
| LogP ≤ 5 | 6.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|