C31H29Cl2N5O — CID 66805579
5-(3,4-dichlorophenyl)-3-(4-methoxycyclohexyl)imino-N-(2-methyl-3-pyridinyl)phenazin-2-amine (PubChem CID 66805579) has the molecular formula C31H29Cl2N5O and a molecular weight of 558.51 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-3-(4-methoxycyclohexyl)imino-N-(2-methyl-3-pyridinyl)phenazin-2-amine.
| Compound Name | 5-(3,4-dichlorophenyl)-3-(4-methoxycyclohexyl)imino-N-(2-methyl-3-pyridinyl)phenazin-2-amine |
|---|---|
| PubChem CID | 66805579 |
| Molecular Formula | C31H29Cl2N5O |
| Molecular Weight | 558.51 g/mol |
| Exact Mass | 557.17 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-3-(4-methoxycyclohexyl)imino-N-(2-methyl-3-pyridinyl)phenazin-2-amine |
| SMILES | COC1CCC(/N=c2\cc3n(-c4ccc(Cl)c(Cl)c4)c4ccccc4nc-3cc2Nc2cccnc2C)CC1 |
| InChI | InChI=1S/C31H29Cl2N5O/c1-19-25(7-5-15-34-19)36-27-17-29-31(18-28(27)35-20-9-12-22(39-2)13-10-20)38(21-11-14-23(32)24(33)16-21)30-8-4-3-6-26(30)37-29/h3-8,11,14-18,20,22,36H,9-10,12-13H2,1-2H3/b35-28+ |
| InChIKey | AYCQFFHNGFUXNJ-AWQADKOQSA-N |
| XLogP | 7.74 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.51 |
| LogP ≤ 5 | 7.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|