C28H22F3N5O2 — CID 66806320
3-cyclopropylimino-N-(2-methoxy-3-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine (PubChem CID 66806320) has the molecular formula C28H22F3N5O2 and a molecular weight of 517.51 g/mol. Its IUPAC name is 3-cyclopropylimino-N-(2-methoxy-3-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine.
| Compound Name | 3-cyclopropylimino-N-(2-methoxy-3-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine |
|---|---|
| PubChem CID | 66806320 |
| Molecular Formula | C28H22F3N5O2 |
| Molecular Weight | 517.51 g/mol |
| Exact Mass | 517.17 |
| IUPAC Name | 3-cyclopropylimino-N-(2-methoxy-3-pyridinyl)-5-[4-(trifluoromethoxy)phenyl]phenazin-2-amine |
| SMILES | COc1ncccc1Nc1cc2nc3ccccc3n(-c3ccc(OC(F)(F)F)cc3)c-2c/c1=N\C1CC1 |
| InChI | InChI=1S/C28H22F3N5O2/c1-37-27-21(6-4-14-32-27)35-22-15-24-26(16-23(22)33-17-8-9-17)36(25-7-3-2-5-20(25)34-24)18-10-12-19(13-11-18)38-28(29,30)31/h2-7,10-17,35H,8-9H2,1H3/b33-23+ |
| InChIKey | HJNRHESDLYHUQW-GZZLJNBRSA-N |
| XLogP | 6.24 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.51 |
| LogP ≤ 5 | 6.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|