C31H27F4N5O3 — CID 68625198
4-[[7-fluoro-3-[(2-methoxy-3-pyridinyl)amino]-10-[4-(trifluoromethoxy)phenyl]phenazin-2-ylidene]amino]cyclohexan-1-ol (PubChem CID 68625198) has the molecular formula C31H27F4N5O3 and a molecular weight of 593.58 g/mol. Its IUPAC name is 4-[[7-fluoro-3-[(2-methoxy-3-pyridinyl)amino]-10-[4-(trifluoromethoxy)phenyl]phenazin-2-ylidene]amino]cyclohexan-1-ol.
| Compound Name | 4-[[7-fluoro-3-[(2-methoxy-3-pyridinyl)amino]-10-[4-(trifluoromethoxy)phenyl]phenazin-2-ylidene]amino]cyclohexan-1-ol |
|---|---|
| PubChem CID | 68625198 |
| Molecular Formula | C31H27F4N5O3 |
| Molecular Weight | 593.58 g/mol |
| Exact Mass | 593.21 |
| IUPAC Name | 4-[[7-fluoro-3-[(2-methoxy-3-pyridinyl)amino]-10-[4-(trifluoromethoxy)phenyl]phenazin-2-ylidene]amino]cyclohexan-1-ol |
| SMILES | COc1ncccc1Nc1cc2nc3cc(F)ccc3n(-c3ccc(OC(F)(F)F)cc3)c-2c/c1=N\C1CCC(O)CC1 |
| InChI | InChI=1S/C31H27F4N5O3/c1-42-30-23(3-2-14-36-30)38-24-16-27-29(17-25(24)37-19-5-9-21(41)10-6-19)40(28-13-4-18(32)15-26(28)39-27)20-7-11-22(12-8-20)43-31(33,34)35/h2-4,7-8,11-17,19,21,38,41H,5-6,9-10H2,1H3/b37-25+ |
| InChIKey | YYFCTNYKHBPGQL-AUGOTPMTSA-N |
| XLogP | 6.52 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.58 |
| LogP ≤ 5 | 6.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|