C31H30BrN5O2 — CID 66806302
5-(4-bromophenyl)-3-(4-methoxycyclohexyl)imino-N-(2-methoxy-3-pyridinyl)phenazin-2-amine (PubChem CID 66806302) has the molecular formula C31H30BrN5O2 and a molecular weight of 584.52 g/mol. Its IUPAC name is 5-(4-bromophenyl)-3-(4-methoxycyclohexyl)imino-N-(2-methoxy-3-pyridinyl)phenazin-2-amine.
| Compound Name | 5-(4-bromophenyl)-3-(4-methoxycyclohexyl)imino-N-(2-methoxy-3-pyridinyl)phenazin-2-amine |
|---|---|
| PubChem CID | 66806302 |
| Molecular Formula | C31H30BrN5O2 |
| Molecular Weight | 584.52 g/mol |
| Exact Mass | 583.16 |
| IUPAC Name | 5-(4-bromophenyl)-3-(4-methoxycyclohexyl)imino-N-(2-methoxy-3-pyridinyl)phenazin-2-amine |
| SMILES | COc1ncccc1Nc1cc2nc3ccccc3n(-c3ccc(Br)cc3)c-2c/c1=N\C1CCC(OC)CC1 |
| InChI | InChI=1S/C31H30BrN5O2/c1-38-23-15-11-21(12-16-23)34-27-19-30-28(18-26(27)36-25-7-5-17-33-31(25)39-2)35-24-6-3-4-8-29(24)37(30)22-13-9-20(32)10-14-22/h3-10,13-14,17-19,21,23,36H,11-12,15-16H2,1-2H3/b34-27+ |
| InChIKey | TVDMNAVEYCMHEO-DNGXXSEMSA-N |
| XLogP | 6.90 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.52 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|