C29H27N5O2 — CID 68632725
N-(2-methoxy-3-pyridinyl)-3-(oxan-4-ylimino)-5-phenylphenazin-2-amine (PubChem CID 68632725) has the molecular formula C29H27N5O2 and a molecular weight of 477.57 g/mol. Its IUPAC name is N-(2-methoxy-3-pyridinyl)-3-(oxan-4-ylimino)-5-phenylphenazin-2-amine.
| Compound Name | N-(2-methoxy-3-pyridinyl)-3-(oxan-4-ylimino)-5-phenylphenazin-2-amine |
|---|---|
| PubChem CID | 68632725 |
| Molecular Formula | C29H27N5O2 |
| Molecular Weight | 477.57 g/mol |
| Exact Mass | 477.22 |
| IUPAC Name | N-(2-methoxy-3-pyridinyl)-3-(oxan-4-ylimino)-5-phenylphenazin-2-amine |
| SMILES | COc1ncccc1Nc1cc2nc3ccccc3n(-c3ccccc3)c-2c/c1=N\C1CCOCC1 |
| InChI | InChI=1S/C29H27N5O2/c1-35-29-23(11-7-15-30-29)33-24-18-26-28(19-25(24)31-20-13-16-36-17-14-20)34(21-8-3-2-4-9-21)27-12-6-5-10-22(27)32-26/h2-12,15,18-20,33H,13-14,16-17H2,1H3/b31-25+ |
| InChIKey | UZEBFLPWKYPSED-QCKNELIISA-N |
| XLogP | 5.36 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.57 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|