C30H28FN5O — CID 68624482
3-cyclohexylimino-5-(4-fluorophenyl)-N-(2-methoxy-3-pyridinyl)phenazin-2-amine (PubChem CID 68624482) has the molecular formula C30H28FN5O and a molecular weight of 493.59 g/mol. Its IUPAC name is 3-cyclohexylimino-5-(4-fluorophenyl)-N-(2-methoxy-3-pyridinyl)phenazin-2-amine.
| Compound Name | 3-cyclohexylimino-5-(4-fluorophenyl)-N-(2-methoxy-3-pyridinyl)phenazin-2-amine |
|---|---|
| PubChem CID | 68624482 |
| Molecular Formula | C30H28FN5O |
| Molecular Weight | 493.59 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | 3-cyclohexylimino-5-(4-fluorophenyl)-N-(2-methoxy-3-pyridinyl)phenazin-2-amine |
| SMILES | COc1ncccc1Nc1cc2nc3ccccc3n(-c3ccc(F)cc3)c-2c/c1=N\C1CCCCC1 |
| InChI | InChI=1S/C30H28FN5O/c1-37-30-24(11-7-17-32-30)35-25-18-27-29(19-26(25)33-21-8-3-2-4-9-21)36(22-15-13-20(31)14-16-22)28-12-6-5-10-23(28)34-27/h5-7,10-19,21,35H,2-4,8-9H2,1H3/b33-26+ |
| InChIKey | IEZJNFUSLYVHNU-MHTZHOPKSA-N |
| XLogP | 6.65 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.59 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|