C30H28FN5 — CID 66631986
3-cyclohexylimino-5-(4-fluorophenyl)-N-(6-methyl-3-pyridinyl)phenazin-2-amine (PubChem CID 66631986) has the molecular formula C30H28FN5 and a molecular weight of 477.59 g/mol. Its IUPAC name is 3-cyclohexylimino-5-(4-fluorophenyl)-N-(6-methyl-3-pyridinyl)phenazin-2-amine.
| Compound Name | 3-cyclohexylimino-5-(4-fluorophenyl)-N-(6-methyl-3-pyridinyl)phenazin-2-amine |
|---|---|
| PubChem CID | 66631986 |
| Molecular Formula | C30H28FN5 |
| Molecular Weight | 477.59 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 3-cyclohexylimino-5-(4-fluorophenyl)-N-(6-methyl-3-pyridinyl)phenazin-2-amine |
| SMILES | Cc1ccc(Nc2cc3nc4ccccc4n(-c4ccc(F)cc4)c-3c/c2=N\C2CCCCC2)cn1 |
| InChI | InChI=1S/C30H28FN5/c1-20-11-14-23(19-32-20)34-26-17-28-30(18-27(26)33-22-7-3-2-4-8-22)36(24-15-12-21(31)13-16-24)29-10-6-5-9-25(29)35-28/h5-6,9-19,22,34H,2-4,7-8H2,1H3/b33-27+ |
| InChIKey | MIYACVBZOAVQAP-MUGXBBEHSA-N |
| XLogP | 6.95 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.59 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|