C32H29FN6O — CID 66806363
5-(4-fluorophenyl)-7-(4-methoxycyclohexyl)imino-8-[(6-methyl-3-pyridinyl)amino]phenazine-2-carbonitrile (PubChem CID 66806363) has the molecular formula C32H29FN6O and a molecular weight of 532.62 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-7-(4-methoxycyclohexyl)imino-8-[(6-methyl-3-pyridinyl)amino]phenazine-2-carbonitrile.
| Compound Name | 5-(4-fluorophenyl)-7-(4-methoxycyclohexyl)imino-8-[(6-methyl-3-pyridinyl)amino]phenazine-2-carbonitrile |
|---|---|
| PubChem CID | 66806363 |
| Molecular Formula | C32H29FN6O |
| Molecular Weight | 532.62 g/mol |
| Exact Mass | 532.24 |
| IUPAC Name | 5-(4-fluorophenyl)-7-(4-methoxycyclohexyl)imino-8-[(6-methyl-3-pyridinyl)amino]phenazine-2-carbonitrile |
| SMILES | COC1CCC(/N=c2\cc3n(-c4ccc(F)cc4)c4ccc(C#N)cc4nc-3cc2Nc2ccc(C)nc2)CC1 |
| InChI | InChI=1S/C32H29FN6O/c1-20-3-7-24(19-35-20)37-27-16-30-32(17-28(27)36-23-8-12-26(40-2)13-9-23)39(25-10-5-22(33)6-11-25)31-14-4-21(18-34)15-29(31)38-30/h3-7,10-11,14-17,19,23,26,37H,8-9,12-13H2,1-2H3/b36-28+ |
| InChIKey | JDJDUMMGNPKZSS-FDEZRRJOSA-N |
| XLogP | 6.45 |
| TPSA | 88.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.62 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|