C31H30FN5O — CID 140651465
3-(4-ethoxycyclohexyl)imino-5-(4-fluorophenyl)-N-pyridin-2-ylphenazin-2-amine (PubChem CID 140651465) has the molecular formula C31H30FN5O and a molecular weight of 507.61 g/mol. Its IUPAC name is 3-(4-ethoxycyclohexyl)imino-5-(4-fluorophenyl)-N-pyridin-2-ylphenazin-2-amine.
| Compound Name | 3-(4-ethoxycyclohexyl)imino-5-(4-fluorophenyl)-N-pyridin-2-ylphenazin-2-amine |
|---|---|
| PubChem CID | 140651465 |
| Molecular Formula | C31H30FN5O |
| Molecular Weight | 507.61 g/mol |
| Exact Mass | 507.24 |
| IUPAC Name | 3-(4-ethoxycyclohexyl)imino-5-(4-fluorophenyl)-N-pyridin-2-ylphenazin-2-amine |
| SMILES | CCOC1CCC(/N=c2\cc3n(-c4ccc(F)cc4)c4ccccc4nc-3cc2Nc2ccccn2)CC1 |
| InChI | InChI=1S/C31H30FN5O/c1-2-38-24-16-12-22(13-17-24)34-27-20-30-28(19-26(27)36-31-9-5-6-18-33-31)35-25-7-3-4-8-29(25)37(30)23-14-10-21(32)11-15-23/h3-11,14-15,18-20,22,24H,2,12-13,16-17H2,1H3,(H,33,36)/b34-27+ |
| InChIKey | VMXXMUOTFQGCMC-DNGXXSEMSA-N |
| XLogP | 6.66 |
| TPSA | 64.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.61 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|