C30H26F2N6O2 — CID 87160235
5-(3,4-difluorophenyl)-3-(4-methoxycyclohexyl)imino-N-(5-nitroso-2-pyridinyl)phenazin-2-amine (PubChem CID 87160235) has the molecular formula C30H26F2N6O2 and a molecular weight of 540.57 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-3-(4-methoxycyclohexyl)imino-N-(5-nitroso-2-pyridinyl)phenazin-2-amine.
| Compound Name | 5-(3,4-difluorophenyl)-3-(4-methoxycyclohexyl)imino-N-(5-nitroso-2-pyridinyl)phenazin-2-amine |
|---|---|
| PubChem CID | 87160235 |
| Molecular Formula | C30H26F2N6O2 |
| Molecular Weight | 540.57 g/mol |
| Exact Mass | 540.21 |
| IUPAC Name | 5-(3,4-difluorophenyl)-3-(4-methoxycyclohexyl)imino-N-(5-nitroso-2-pyridinyl)phenazin-2-amine |
| SMILES | COC1CCC(/N=c2\cc3n(-c4ccc(F)c(F)c4)c4ccccc4nc-3cc2Nc2ccc(N=O)cn2)CC1 |
| InChI | InChI=1S/C30H26F2N6O2/c1-40-21-10-6-18(7-11-21)34-26-16-29-27(15-25(26)36-30-13-8-19(37-39)17-33-30)35-24-4-2-3-5-28(24)38(29)20-9-12-22(31)23(32)14-20/h2-5,8-9,12-18,21H,6-7,10-11H2,1H3,(H,33,36)/b34-26+ |
| InChIKey | FXZQKOYVPQZKNG-JJNGWGCYSA-N |
| XLogP | 6.80 |
| TPSA | 93.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.57 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|