C29H24Cl2FN5O2 — CID 66806358
5-(3,4-dichlorophenyl)-8-fluoro-N-(2-methoxy-3-pyridinyl)-3-(oxan-4-ylimino)phenazin-2-amine (PubChem CID 66806358) has the molecular formula C29H24Cl2FN5O2 and a molecular weight of 564.45 g/mol. Its IUPAC name is 5-(3,4-dichlorophenyl)-8-fluoro-N-(2-methoxy-3-pyridinyl)-3-(oxan-4-ylimino)phenazin-2-amine.
| Compound Name | 5-(3,4-dichlorophenyl)-8-fluoro-N-(2-methoxy-3-pyridinyl)-3-(oxan-4-ylimino)phenazin-2-amine |
|---|---|
| PubChem CID | 66806358 |
| Molecular Formula | C29H24Cl2FN5O2 |
| Molecular Weight | 564.45 g/mol |
| Exact Mass | 563.13 |
| IUPAC Name | 5-(3,4-dichlorophenyl)-8-fluoro-N-(2-methoxy-3-pyridinyl)-3-(oxan-4-ylimino)phenazin-2-amine |
| SMILES | COc1ncccc1Nc1cc2nc3cc(F)ccc3n(-c3ccc(Cl)c(Cl)c3)c-2c/c1=N\C1CCOCC1 |
| InChI | InChI=1S/C29H24Cl2FN5O2/c1-38-29-22(3-2-10-33-29)35-23-15-26-28(16-24(23)34-18-8-11-39-12-9-18)37(19-5-6-20(30)21(31)14-19)27-7-4-17(32)13-25(27)36-26/h2-7,10,13-16,18,35H,8-9,11-12H2,1H3/b34-24+ |
| InChIKey | WBDJNSDMRUCMPK-JGRMKTMXSA-N |
| XLogP | 6.80 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.45 |
| LogP ≤ 5 | 6.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|