C31H27F3N6O2 — CID 66806345
N-[5-[[3-(oxan-4-ylimino)-5-[4-(trifluoromethyl)phenyl]phenazin-2-yl]amino]-2-pyridinyl]acetamide (PubChem CID 66806345) has the molecular formula C31H27F3N6O2 and a molecular weight of 572.59 g/mol. Its IUPAC name is N-[5-[[3-(oxan-4-ylimino)-5-[4-(trifluoromethyl)phenyl]phenazin-2-yl]amino]-2-pyridinyl]acetamide.
| Compound Name | N-[5-[[3-(oxan-4-ylimino)-5-[4-(trifluoromethyl)phenyl]phenazin-2-yl]amino]-2-pyridinyl]acetamide |
|---|---|
| PubChem CID | 66806345 |
| Molecular Formula | C31H27F3N6O2 |
| Molecular Weight | 572.59 g/mol |
| Exact Mass | 572.21 |
| IUPAC Name | N-[5-[[3-(oxan-4-ylimino)-5-[4-(trifluoromethyl)phenyl]phenazin-2-yl]amino]-2-pyridinyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Nc2cc3nc4ccccc4n(-c4ccc(C(F)(F)F)cc4)c-3c/c2=N\C2CCOCC2)cn1 |
| InChI | InChI=1S/C31H27F3N6O2/c1-19(41)36-30-11-8-22(18-35-30)38-25-16-27-29(17-26(25)37-21-12-14-42-15-13-21)40(28-5-3-2-4-24(28)39-27)23-9-6-20(7-10-23)31(32,33)34/h2-11,16-18,21,38H,12-15H2,1H3,(H,35,36,41)/b37-26+ |
| InChIKey | RXDMBUKWHDGFJW-AVLPFNLUSA-N |
| XLogP | 6.33 |
| TPSA | 93.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.59 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|