C30H26F3N5O — CID 160716464
1-[5-[[3-propan-2-ylimino-5-[4-(trifluoromethyl)phenyl]phenazin-2-yl]amino]-2-pyridinyl]propan-2-one (PubChem CID 160716464) has the molecular formula C30H26F3N5O and a molecular weight of 529.57 g/mol. Its IUPAC name is 1-[5-[[3-propan-2-ylimino-5-[4-(trifluoromethyl)phenyl]phenazin-2-yl]amino]-2-pyridinyl]propan-2-one.
| Compound Name | 1-[5-[[3-propan-2-ylimino-5-[4-(trifluoromethyl)phenyl]phenazin-2-yl]amino]-2-pyridinyl]propan-2-one |
|---|---|
| PubChem CID | 160716464 |
| Molecular Formula | C30H26F3N5O |
| Molecular Weight | 529.57 g/mol |
| Exact Mass | 529.21 |
| IUPAC Name | 1-[5-[[3-propan-2-ylimino-5-[4-(trifluoromethyl)phenyl]phenazin-2-yl]amino]-2-pyridinyl]propan-2-one |
| SMILES | CC(=O)Cc1ccc(Nc2cc3nc4ccccc4n(-c4ccc(C(F)(F)F)cc4)c-3c/c2=N\C(C)C)cn1 |
| InChI | InChI=1S/C30H26F3N5O/c1-18(2)35-26-16-29-27(15-25(26)36-22-11-10-21(34-17-22)14-19(3)39)37-24-6-4-5-7-28(24)38(29)23-12-8-20(9-13-23)30(31,32)33/h4-13,15-18,36H,14H2,1-3H3/b35-26+ |
| InChIKey | RSNORYIKSUXWMS-MDAYZVFASA-N |
| XLogP | 6.73 |
| TPSA | 72.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.57 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|